C22H24N4S — CID 5223987
5-(5-butylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole (PubChem CID 5223987) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-(5-butylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole.
| Compound Name | 5-(5-butylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 5223987 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-(5-butylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole |
| SMILES | CCCCSc1nnc(-c2ccc3[nH]c(C)c(C)c3c2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H24N4S/c1-4-5-13-27-22-25-24-21(26(22)18-9-7-6-8-10-18)17-11-12-20-19(14-17)15(2)16(3)23-20/h6-12,14,23H,4-5,13H2,1-3H3 |
| InChIKey | WDSRJDTTXNFGPG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|