C19H21ClN4S — CID 134093729
3-[[5-(3-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropan-1-amine (PubChem CID 134093729) has the molecular formula C19H21ClN4S and a molecular weight of 372.93 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-(3-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 134093729 |
| Molecular Formula | C19H21ClN4S |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCSc1nnc(-c2cccc(Cl)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H21ClN4S/c1-23(2)12-7-13-25-19-22-21-18(15-8-6-9-16(20)14-15)24(19)17-10-4-3-5-11-17/h3-6,8-11,14H,7,12-13H2,1-2H3 |
| InChIKey | TXYFMKXNCOTIJE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|