C17H17N3OS — CID 78827340
3-(2-methoxyethylsulfanyl)-4,5-diphenyl-1,2,4-triazole (PubChem CID 78827340) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfanyl)-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-(2-methoxyethylsulfanyl)-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 78827340 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-(2-methoxyethylsulfanyl)-4,5-diphenyl-1,2,4-triazole |
| SMILES | COCCSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C17H17N3OS/c1-21-12-13-22-17-19-18-16(14-8-4-2-5-9-14)20(17)15-10-6-3-7-11-15/h2-11H,12-13H2,1H3 |
| InChIKey | BQHZMJWLXHLGBR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|