C16H15N3S — CID 893283
3-ethylsulfanyl-4,5-diphenyl-1,2,4-triazole (PubChem CID 893283) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-ethylsulfanyl-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-ethylsulfanyl-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 893283 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-ethylsulfanyl-4,5-diphenyl-1,2,4-triazole |
| SMILES | CCSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C16H15N3S/c1-2-20-16-18-17-15(13-9-5-3-6-10-13)19(16)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | FJXLSCRPRNOUAO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |