C18H21N4OS+ — CID 2077730
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium (PubChem CID 2077730) has the molecular formula C18H21N4OS+ and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2077730 |
| Molecular Formula | C18H21N4OS+ |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH2+]CCSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C18H20N4OS/c23-13-11-19-12-14-24-18-21-20-17(15-7-3-1-4-8-15)22(18)16-9-5-2-6-10-16/h1-10,19,23H,11-14H2/p+1 |
| InChIKey | CCLPZQULPYFFCQ-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|