C11H13N3S — CID 7205487
3-ethylsulfanyl-5-methyl-4-phenyl-1,2,4-triazole (PubChem CID 7205487) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-methyl-4-phenyl-1,2,4-triazole.
| Compound Name | 3-ethylsulfanyl-5-methyl-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 7205487 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-ethylsulfanyl-5-methyl-4-phenyl-1,2,4-triazole |
| SMILES | CCSc1nnc(C)n1-c1ccccc1 |
| InChI | InChI=1S/C11H13N3S/c1-3-15-11-13-12-9(2)14(11)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| InChIKey | VSSXZYYEAMDZNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |