C24H23N3O2S — CID 2193973
4-(4-methoxyphenyl)-3-[2-(4-methylphenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole (PubChem CID 2193973) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-[2-(4-methylphenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole.
| Compound Name | 4-(4-methoxyphenyl)-3-[2-(4-methylphenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 2193973 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-[2-(4-methylphenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole |
| SMILES | COc1ccc(-n2c(SCCOc3ccc(C)cc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c1-18-8-12-22(13-9-18)29-16-17-30-24-26-25-23(19-6-4-3-5-7-19)27(24)20-10-14-21(28-2)15-11-20/h3-15H,16-17H2,1-2H3 |
| InChIKey | STMNVHZTIAIWFX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|