C24H21N3O4S — CID 4578950
3-(1,3-benzodioxol-5-yl)-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 4578950) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4578950 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | COc1ccc(OCCSc2nnc(-c3ccc4c(c3)OCO4)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-28-19-8-10-20(11-9-19)29-13-14-32-24-26-25-23(27(24)18-5-3-2-4-6-18)17-7-12-21-22(15-17)31-16-30-21/h2-12,15H,13-14,16H2,1H3 |
| InChIKey | RUGAGIZCJQYTAO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|