C23H19Cl2N3OS — CID 126107211
3,4-bis(4-chlorophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole (PubChem CID 126107211) has the molecular formula C23H19Cl2N3OS and a molecular weight of 456.40 g/mol. Its IUPAC name is 3,4-bis(4-chlorophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 3,4-bis(4-chlorophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 126107211 |
| Molecular Formula | C23H19Cl2N3OS |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 3,4-bis(4-chlorophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1ccc(OCCSc2nnc(-c3ccc(Cl)cc3)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3OS/c1-16-2-12-21(13-3-16)29-14-15-30-23-27-26-22(17-4-6-18(24)7-5-17)28(23)20-10-8-19(25)9-11-20/h2-13H,14-15H2,1H3 |
| InChIKey | XAUZYKSYMMATIE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|