C24H22ClN3OS2 — CID 21014008
3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-1,2,4-triazole (PubChem CID 21014008) has the molecular formula C24H22ClN3OS2 and a molecular weight of 468.05 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21014008 |
| Molecular Formula | C24H22ClN3OS2 |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-1,2,4-triazole |
| SMILES | Cc1ccc(SCc2nnc(SCCOc3ccc(Cl)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22ClN3OS2/c1-18-7-13-22(14-8-18)31-17-23-26-27-24(28(23)20-5-3-2-4-6-20)30-16-15-29-21-11-9-19(25)10-12-21/h2-14H,15-17H2,1H3 |
| InChIKey | SYZNFCAWIKQDRF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|