C25H22N4OS3 — CID 3431486
2-[[5-[2-(4-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 3431486) has the molecular formula C25H22N4OS3 and a molecular weight of 490.68 g/mol. Its IUPAC name is 2-[[5-[2-(4-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[5-[2-(4-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3431486 |
| Molecular Formula | C25H22N4OS3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[[5-[2-(4-methylphenoxy)ethylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(OCCSc2nnc(CSc3nc4ccccc4s3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4OS3/c1-18-11-13-20(14-12-18)30-15-16-31-24-28-27-23(29(24)19-7-3-2-4-8-19)17-32-25-26-21-9-5-6-10-22(21)33-25/h2-14H,15-17H2,1H3 |
| InChIKey | ANQUKHINLOGJEY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|