C20H20N4OS3 — CID 27921871
2-[[4-benzyl-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 27921871) has the molecular formula C20H20N4OS3 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-benzyl-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 27921871 |
| Molecular Formula | C20H20N4OS3 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[[4-benzyl-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-3-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | COCCSc1nnc(CSc2nc3ccccc3s2)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N4OS3/c1-25-11-12-26-19-23-22-18(24(19)13-15-7-3-2-4-8-15)14-27-20-21-16-9-5-6-10-17(16)28-20/h2-10H,11-14H2,1H3 |
| InChIKey | FEFLODCYRZXWFR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|