C23H20N6OS3 — CID 4652811
3-amino-2-[2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-benzyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile (PubChem CID 4652811) has the molecular formula C23H20N6OS3 and a molecular weight of 492.66 g/mol. Its IUPAC name is 3-amino-2-[2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-benzyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | 3-amino-2-[2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-benzyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 4652811 |
| Molecular Formula | C23H20N6OS3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 3-amino-2-[2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-benzyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]but-2-enenitrile |
| SMILES | CC(N)=C(C#N)C(=O)CSc1nnc(CSc2nc3ccccc3s2)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H20N6OS3/c1-15(25)17(11-24)19(30)13-31-22-28-27-21(29(22)12-16-7-3-2-4-8-16)14-32-23-26-18-9-5-6-10-20(18)33-23/h2-10H,12-14,25H2,1H3 |
| InChIKey | YKYCPNBPFKFJDP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|