C16H12N4S3 — CID 1185870
3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 1185870) has the molecular formula C16H12N4S3 and a molecular weight of 356.50 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1185870 |
| Molecular Formula | C16H12N4S3 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CSc2nc3ccccc3s2)n1-c1ccccc1 |
| InChI | InChI=1S/C16H12N4S3/c21-15-19-18-14(20(15)11-6-2-1-3-7-11)10-22-16-17-12-8-4-5-9-13(12)23-16/h1-9H,10H2,(H,19,21) |
| InChIKey | DEYCSCCQLNRYNL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|