C21H21N5OS3 — CID 2635966
5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 2635966) has the molecular formula C21H21N5OS3 and a molecular weight of 455.63 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2635966 |
| Molecular Formula | C21H21N5OS3 |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCOCC2)nc(CSc2nc3ccccc3s2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N5OS3/c28-21-25(15-24-10-12-27-13-11-24)23-19(26(21)16-6-2-1-3-7-16)14-29-20-22-17-8-4-5-9-18(17)30-20/h1-9H,10-15H2 |
| InChIKey | NBUZXAGNQWZMLA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|