C11H14N2OS3 — CID 163844659
4-(1,3-benzothiazol-2-ylsulfanyl)morpholine;sulfane (PubChem CID 163844659) has the molecular formula C11H14N2OS3 and a molecular weight of 286.45 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine;sulfane.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine;sulfane |
|---|---|
| PubChem CID | 163844659 |
| Molecular Formula | C11H14N2OS3 |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)morpholine;sulfane |
| SMILES | S.c1ccc2sc(SN3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H12N2OS2.H2S/c1-2-4-10-9(3-1)12-11(15-10)16-13-5-7-14-8-6-13;/h1-4H,5-8H2;1H2 |
| InChIKey | ZQMVXPFIVCWEBH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|