C16H21N3OS — CID 171691387
4-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine (PubChem CID 171691387) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine.
| Compound Name | 4-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 171691387 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine |
| SMILES | c1ccc2sc(N3CCC(N4CCOCC4)CC3)nc2c1 |
| InChI | InChI=1S/C16H21N3OS/c1-2-4-15-14(3-1)17-16(21-15)19-7-5-13(6-8-19)18-9-11-20-12-10-18/h1-4,13H,5-12H2 |
| InChIKey | PKWGBQLMQATAOA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |