C13H15ClN2S — CID 102960755
2-(3-chloro-4-methylpiperidin-1-yl)-1,3-benzothiazole (PubChem CID 102960755) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 2-(3-chloro-4-methylpiperidin-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(3-chloro-4-methylpiperidin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 102960755 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-(3-chloro-4-methylpiperidin-1-yl)-1,3-benzothiazole |
| SMILES | CC1CCN(c2nc3ccccc3s2)CC1Cl |
| InChI | InChI=1S/C13H15ClN2S/c1-9-6-7-16(8-10(9)14)13-15-11-4-2-3-5-12(11)17-13/h2-5,9-10H,6-8H2,1H3 |
| InChIKey | BAHNIHXAXAJYIY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|