C18H13F5N2S — CID 175245982
2-[4-(2,3,4,5,6-pentafluorophenyl)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 175245982) has the molecular formula C18H13F5N2S and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-[4-(2,3,4,5,6-pentafluorophenyl)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(2,3,4,5,6-pentafluorophenyl)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 175245982 |
| Molecular Formula | C18H13F5N2S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[4-(2,3,4,5,6-pentafluorophenyl)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | Fc1c(F)c(F)c(C2CCN(c3nc4ccccc4s3)CC2)c(F)c1F |
| InChI | InChI=1S/C18H13F5N2S/c19-13-12(14(20)16(22)17(23)15(13)21)9-5-7-25(8-6-9)18-24-10-3-1-2-4-11(10)26-18/h1-4,9H,5-8H2 |
| InChIKey | WFCNESJUVMBLQB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|