C16H19F2N3OS — CID 171691424
4-[1-(4,6-difluoro-1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine (PubChem CID 171691424) has the molecular formula C16H19F2N3OS and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-[1-(4,6-difluoro-1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine.
| Compound Name | 4-[1-(4,6-difluoro-1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 171691424 |
| Molecular Formula | C16H19F2N3OS |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-[1-(4,6-difluoro-1,3-benzothiazol-2-yl)piperidin-4-yl]morpholine |
| SMILES | Fc1cc(F)c2nc(N3CCC(N4CCOCC4)CC3)sc2c1 |
| InChI | InChI=1S/C16H19F2N3OS/c17-11-9-13(18)15-14(10-11)23-16(19-15)21-3-1-12(2-4-21)20-5-7-22-8-6-20/h9-10,12H,1-8H2 |
| InChIKey | PMVHGJXQFKWDSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |