C14H19FN2OS — CID 167512915
ethane;4-(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)morpholine (PubChem CID 167512915) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is ethane;4-(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)morpholine.
| Compound Name | ethane;4-(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 167512915 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethane;4-(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)morpholine |
| SMILES | CC.Cc1c(F)ccc2sc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C12H13FN2OS.C2H6/c1-8-9(13)2-3-10-11(8)14-12(17-10)15-4-6-16-7-5-15;1-2/h2-3H,4-7H2,1H3;1-2H3 |
| InChIKey | JDTLSVNHUYIIHX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |