C14H20N2OS — CID 167513068
ethane;4-(4-methyl-1,3-benzothiazol-2-yl)morpholine (PubChem CID 167513068) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is ethane;4-(4-methyl-1,3-benzothiazol-2-yl)morpholine.
| Compound Name | ethane;4-(4-methyl-1,3-benzothiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 167513068 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | ethane;4-(4-methyl-1,3-benzothiazol-2-yl)morpholine |
| SMILES | CC.Cc1cccc2sc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C12H14N2OS.C2H6/c1-9-3-2-4-10-11(9)13-12(16-10)14-5-7-15-8-6-14;1-2/h2-4H,5-8H2,1H3;1-2H3 |
| InChIKey | GVEJAMZPMPWXLU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |