C18H20N4O2S2 — CID 171999825
4-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]benzenesulfonamide (PubChem CID 171999825) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 171999825 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]benzenesulfonamide |
| SMILES | Cc1cccc2sc(N3CCN(c4ccc(S(N)(=O)=O)cc4)CC3)nc12 |
| InChI | InChI=1S/C18H20N4O2S2/c1-13-3-2-4-16-17(13)20-18(25-16)22-11-9-21(10-12-22)14-5-7-15(8-6-14)26(19,23)24/h2-8H,9-12H2,1H3,(H2,19,23,24) |
| InChIKey | SUFKOAUEQVLIJL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |