C18H24FN3O3S — CID 170265301
7-[(5-fluoro-2-morpholin-4-yl-1,3-benzothiazol-4-yl)oxy]heptanamide (PubChem CID 170265301) has the molecular formula C18H24FN3O3S and a molecular weight of 381.47 g/mol. Its IUPAC name is 7-[(5-fluoro-2-morpholin-4-yl-1,3-benzothiazol-4-yl)oxy]heptanamide.
| Compound Name | 7-[(5-fluoro-2-morpholin-4-yl-1,3-benzothiazol-4-yl)oxy]heptanamide |
|---|---|
| PubChem CID | 170265301 |
| Molecular Formula | C18H24FN3O3S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 7-[(5-fluoro-2-morpholin-4-yl-1,3-benzothiazol-4-yl)oxy]heptanamide |
| SMILES | NC(=O)CCCCCCOc1c(F)ccc2sc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C18H24FN3O3S/c19-13-6-7-14-16(21-18(26-14)22-8-11-24-12-9-22)17(13)25-10-4-2-1-3-5-15(20)23/h6-7H,1-5,8-12H2,(H2,20,23) |
| InChIKey | SQSWLHBYJZDOEG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|