C22H30N2O4S — CID 171565171
9-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]nonanoic acid (PubChem CID 171565171) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 9-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]nonanoic acid.
| Compound Name | 9-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]nonanoic acid |
|---|---|
| PubChem CID | 171565171 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 9-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]nonanoic acid |
| SMILES | O=C(O)CCCCCCCCOc1ccc(-c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c25-21(26)7-5-3-1-2-4-6-14-28-19-10-8-18(9-11-19)20-17-29-22(23-20)24-12-15-27-16-13-24/h8-11,17H,1-7,12-16H2,(H,25,26) |
| InChIKey | WQXPLFHAJPTNJD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|