C15H15ClFN3O2S — CID 166427762
2-chloro-2-fluoro-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 166427762) has the molecular formula C15H15ClFN3O2S and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-chloro-2-fluoro-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 166427762 |
| Molecular Formula | C15H15ClFN3O2S |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-chloro-2-fluoro-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(-c2csc(N3CCOCC3)n2)cc1)C(F)Cl |
| InChI | InChI=1S/C15H15ClFN3O2S/c16-13(17)14(21)18-11-3-1-10(2-4-11)12-9-23-15(19-12)20-5-7-22-8-6-20/h1-4,9,13H,5-8H2,(H,18,21) |
| InChIKey | NMIWLSYNGGHXMB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|