C24H28N4O2S — CID 18272653
3-[4-(dimethylamino)phenyl]-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide (PubChem CID 18272653) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 18272653 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-[4-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide |
| SMILES | CN(C)c1ccc(CCC(=O)Nc2ccc(-c3csc(N4CCOCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C24H28N4O2S/c1-27(2)21-10-3-18(4-11-21)5-12-23(29)25-20-8-6-19(7-9-20)22-17-31-24(26-22)28-13-15-30-16-14-28/h3-4,6-11,17H,5,12-16H2,1-2H3,(H,25,29) |
| InChIKey | GZUXZNOBWMCYKV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|