C21H21N3OS — CID 4224043
2-phenyl-N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 4224043) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-phenyl-N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-phenyl-N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4224043 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-phenyl-N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(-c2csc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C21H21N3OS/c25-20(14-16-6-2-1-3-7-16)22-18-10-8-17(9-11-18)19-15-26-21(23-19)24-12-4-5-13-24/h1-3,6-11,15H,4-5,12-14H2,(H,22,25) |
| InChIKey | UGATUKRVINFUIG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |