C15H16N2O2S — CID 58256899
4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid (PubChem CID 58256899) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid.
| Compound Name | 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 58256899 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2csc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H16N2O2S/c18-14(19)12-6-4-11(5-7-12)13-10-20-15(16-13)17-8-2-1-3-9-17/h4-7,10H,1-3,8-9H2,(H,18,19) |
| InChIKey | MDYHBLVQVAEYCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |