4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid

C15H16N2O2S — CID 58256899

IUPAC4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2csc(N3CCCCC3)n2)cc1
InChIInChI=1S/C15H16N2O2S/c18-14(19)12-6-4-11(5-7-12)13-10-20-15(16-13)17-8-2-1-3-9-17/h4-7,10H,1-3,8-9H2,(H,18,19)
InChIKeyMDYHBLVQVAEYCU-UHFFFAOYSA-N
MW288.37 g/mol
LogP3.50
Rot. Bonds3

About 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid

4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid (PubChem CID 58256899) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid.

Molecular Properties

Compound Name4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid
PubChem CID58256899
Molecular FormulaC15H16N2O2S
Molecular Weight288.37 g/mol
Exact Mass288.09
IUPAC Name4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2csc(N3CCCCC3)n2)cc1
InChIInChI=1S/C15H16N2O2S/c18-14(19)12-6-4-11(5-7-12)13-10-20-15(16-13)17-8-2-1-3-9-17/h4-7,10H,1-3,8-9H2,(H,18,19)
InChIKeyMDYHBLVQVAEYCU-UHFFFAOYSA-N
XLogP3.50
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.37
LogP ≤ 53.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid?
The IUPAC name of 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid (CID 58256899) is 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid.
What is the SMILES notation for 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid?
The canonical SMILES for 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid is O=C(O)c1ccc(-c2csc(N3CCCCC3)n2)cc1.
What is the InChIKey of 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid?
The InChIKey is MDYHBLVQVAEYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c18-14(19)12-6-4-11(5-7-12)13-10-20-15(16-13)17-8-2-1-3-9-17/h4-7,10H,1-3,8-9H2,(H,18,19).
What are the key properties of 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid?
4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid has a molecular weight of 288.37 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-piperidin-1-yl-1,3-thiazol-4-yl)benzoic acid is sourced from PubChem (CID 58256899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).