C26H23N3OS — CID 3443960
4-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 3443960) has the molecular formula C26H23N3OS and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | 4-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3443960 |
| Molecular Formula | C26H23N3OS |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2csc(N3CCCC3)n2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3OS/c30-25(21-13-11-20(12-14-21)19-7-2-1-3-8-19)27-23-10-6-9-22(17-23)24-18-31-26(28-24)29-15-4-5-16-29/h1-3,6-14,17-18H,4-5,15-16H2,(H,27,30) |
| InChIKey | USQFTGAMOFZOTH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |