C23H33N3OS — CID 42663636
N-[3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]nonanamide (PubChem CID 42663636) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is N-[3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]nonanamide.
| Compound Name | N-[3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]nonanamide |
|---|---|
| PubChem CID | 42663636 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1cccc(-c2csc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C23H33N3OS/c1-2-3-4-5-6-8-14-22(27)24-20-13-11-12-19(17-20)21-18-28-23(25-21)26-15-9-7-10-16-26/h11-13,17-18H,2-10,14-16H2,1H3,(H,24,27) |
| InChIKey | UHBXFFDPFNPVRB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|