C23H33N3OS — CID 3976277
N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]decanamide (PubChem CID 3976277) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]decanamide.
| Compound Name | N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]decanamide |
|---|---|
| PubChem CID | 3976277 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[4-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(-c2csc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C23H33N3OS/c1-2-3-4-5-6-7-8-11-22(27)24-20-14-12-19(13-15-20)21-18-28-23(25-21)26-16-9-10-17-26/h12-15,18H,2-11,16-17H2,1H3,(H,24,27) |
| InChIKey | MEAHXOMNTIEOFP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|