C35H48Cl2N4OS — CID 142182949
2-(azepan-1-yl)-4-(4-methylphenyl)-1,3-thiazole;N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]heptanamide (PubChem CID 142182949) has the molecular formula C35H48Cl2N4OS and a molecular weight of 643.77 g/mol. Its IUPAC name is 2-(azepan-1-yl)-4-(4-methylphenyl)-1,3-thiazole;N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]heptanamide.
| Compound Name | 2-(azepan-1-yl)-4-(4-methylphenyl)-1,3-thiazole;N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]heptanamide |
|---|---|
| PubChem CID | 142182949 |
| Molecular Formula | C35H48Cl2N4OS |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 2-(azepan-1-yl)-4-(4-methylphenyl)-1,3-thiazole;N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1.Cc1ccc(-c2csc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H28Cl2N2O.C16H20N2S/c1-2-3-4-5-6-19(24)22-16-9-11-23(12-10-16)14-15-7-8-17(20)18(21)13-15;1-13-6-8-14(9-7-13)15-12-19-16(17-15)18-10-4-2-3-5-11-18/h7-8,13,16H,2-6,9-12,14H2,1H3,(H,22,24);6-9,12H,2-5,10-11H2,1H3 |
| InChIKey | BTGVJYUUQFSMKN-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|