C24H25Cl2N5O2S2 — CID 21061292
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 21061292) has the molecular formula C24H25Cl2N5O2S2 and a molecular weight of 550.54 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21061292 |
| Molecular Formula | C24H25Cl2N5O2S2 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | N/C(=N\O)c1ccc(-c2csc(SCC(=O)NC3CCN(Cc4ccc(Cl)c(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C24H25Cl2N5O2S2/c25-19-6-1-15(11-20(19)26)12-31-9-7-18(8-10-31)28-22(32)14-35-24-29-21(13-34-24)16-2-4-17(5-3-16)23(27)30-33/h1-6,11,13,18,33H,7-10,12,14H2,(H2,27,30)(H,28,32) |
| InChIKey | QRHYOCKDCLJFFK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|