C24H22Cl2N4OS2 — CID 21061283
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-(3-isocyanophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 21061283) has the molecular formula C24H22Cl2N4OS2 and a molecular weight of 517.51 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-(3-isocyanophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-(3-isocyanophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21061283 |
| Molecular Formula | C24H22Cl2N4OS2 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-2-[[4-(3-isocyanophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | [C-]#[N+]c1cccc(-c2csc(SCC(=O)NC3CCN(Cc4ccc(Cl)c(Cl)c4)CC3)n2)c1 |
| InChI | InChI=1S/C24H22Cl2N4OS2/c1-27-19-4-2-3-17(12-19)22-14-32-24(29-22)33-15-23(31)28-18-7-9-30(10-8-18)13-16-5-6-20(25)21(26)11-16/h2-6,11-12,14,18H,7-10,13,15H2,(H,28,31) |
| InChIKey | QBVPQUSEWSFREG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 49.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|