C23H21Cl3N4O3S2 — CID 21061257
2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]acetamide (PubChem CID 21061257) has the molecular formula C23H21Cl3N4O3S2 and a molecular weight of 571.94 g/mol. Its IUPAC name is 2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 21061257 |
| Molecular Formula | C23H21Cl3N4O3S2 |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | 2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccc(Cl)c([N+](=O)[O-])c2)cs1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C23H21Cl3N4O3S2/c24-17-3-1-14(9-19(17)26)11-29-7-5-16(6-8-29)27-22(31)13-35-23-28-20(12-34-23)15-2-4-18(25)21(10-15)30(32)33/h1-4,9-10,12,16H,5-8,11,13H2,(H,27,31) |
| InChIKey | FWAVMZBANWXRGB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|