C29H35Cl2N5O2S — CID 21061304
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-[4-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenoxy]butanamide (PubChem CID 21061304) has the molecular formula C29H35Cl2N5O2S and a molecular weight of 588.61 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-[4-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenoxy]butanamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-[4-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 21061304 |
| Molecular Formula | C29H35Cl2N5O2S |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-[4-(2-piperazin-1-yl-1,3-thiazol-4-yl)phenoxy]butanamide |
| SMILES | O=C(CCCOc1ccc(-c2csc(N3CCNCC3)n2)cc1)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C29H35Cl2N5O2S/c30-25-8-3-21(18-26(25)31)19-35-13-9-23(10-14-35)33-28(37)2-1-17-38-24-6-4-22(5-7-24)27-20-39-29(34-27)36-15-11-32-12-16-36/h3-8,18,20,23,32H,1-2,9-17,19H2,(H,33,37) |
| InChIKey | OKSGCZRBQYLVKA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|