C29H38Cl2N4OS — CID 67317999
4-[4-[4-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]butoxy]phenyl]-N,N-diethyl-1,3-thiazol-2-amine (PubChem CID 67317999) has the molecular formula C29H38Cl2N4OS and a molecular weight of 561.62 g/mol. Its IUPAC name is 4-[4-[4-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]butoxy]phenyl]-N,N-diethyl-1,3-thiazol-2-amine.
| Compound Name | 4-[4-[4-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]butoxy]phenyl]-N,N-diethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 67317999 |
| Molecular Formula | C29H38Cl2N4OS |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 4-[4-[4-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]butoxy]phenyl]-N,N-diethyl-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1nc(-c2ccc(OCCCCNC3CCN(Cc4ccc(Cl)c(Cl)c4)CC3)cc2)cs1 |
| InChI | InChI=1S/C29H38Cl2N4OS/c1-3-35(4-2)29-33-28(21-37-29)23-8-10-25(11-9-23)36-18-6-5-15-32-24-13-16-34(17-14-24)20-22-7-12-26(30)27(31)19-22/h7-12,19,21,24,32H,3-6,13-18,20H2,1-2H3 |
| InChIKey | IWQDJJBUHFQRDA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|