C23H32N6O — CID 58996574
4-[[4-[3-(4-carbamimidoylphenoxy)propylamino]piperidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 58996574) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-[[4-[3-(4-carbamimidoylphenoxy)propylamino]piperidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[4-[3-(4-carbamimidoylphenoxy)propylamino]piperidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 58996574 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 4-[[4-[3-(4-carbamimidoylphenoxy)propylamino]piperidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCC(NCCCOc3ccc(/C(N)=N/[H])cc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N6O/c24-22(25)18-4-2-17(3-5-18)16-29-13-10-20(11-14-29)28-12-1-15-30-21-8-6-19(7-9-21)23(26)27/h2-9,20,28H,1,10-16H2,(H3,24,25)(H3,26,27) |
| InChIKey | XHUMHKJDIMLOIZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|