C22H31N3OS — CID 7361956
(2S)-2-ethyl-N-[4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide (PubChem CID 7361956) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide.
| Compound Name | (2S)-2-ethyl-N-[4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 7361956 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (2S)-2-ethyl-N-[4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1ccc(-c2csc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H31N3OS/c1-3-5-9-17(4-2)21(26)23-19-12-10-18(11-13-19)20-16-27-22(24-20)25-14-7-6-8-15-25/h10-13,16-17H,3-9,14-15H2,1-2H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | XEKZKZMBSNQLDL-KRWDZBQOSA-N |
| XLogP | 5.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |