C19H26N2OS — CID 3619890
2-ethyl-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]hexanamide (PubChem CID 3619890) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-ethyl-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 2-ethyl-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 3619890 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-ethyl-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCC(CC)C(=O)Nc1nc(-c2ccc(CC)cc2)cs1 |
| InChI | InChI=1S/C19H26N2OS/c1-4-7-8-15(6-3)18(22)21-19-20-17(13-23-19)16-11-9-14(5-2)10-12-16/h9-13,15H,4-8H2,1-3H3,(H,20,21,22) |
| InChIKey | KJUNDGZDEHZWJU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |