C17H18N4OS — CID 43055174
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-pyrazol-1-ylpropanamide (PubChem CID 43055174) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-pyrazol-1-ylpropanamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 43055174 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-pyrazol-1-ylpropanamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)C(C)n3cccn3)n2)cc1 |
| InChI | InChI=1S/C17H18N4OS/c1-3-13-5-7-14(8-6-13)15-11-23-17(19-15)20-16(22)12(2)21-10-4-9-18-21/h4-12H,3H2,1-2H3,(H,19,20,22) |
| InChIKey | RGZXUMKDUSPVMT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |