C20H27N3OS — CID 7261173
(2R)-2-ethyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]hexanamide (PubChem CID 7261173) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is (2R)-2-ethyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]hexanamide.
| Compound Name | (2R)-2-ethyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7261173 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R)-2-ethyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]hexanamide |
| SMILES | C=CCNc1nc(-c2cccc(NC(=O)[C@H](CC)CCCC)c2)cs1 |
| InChI | InChI=1S/C20H27N3OS/c1-4-7-9-15(6-3)19(24)22-17-11-8-10-16(13-17)18-14-25-20(23-18)21-12-5-2/h5,8,10-11,13-15H,2,4,6-7,9,12H2,1,3H3,(H,21,23)(H,22,24)/t15-/m1/s1 |
| InChIKey | SFODGRJQPBCAIG-OAHLLOKOSA-N |
| XLogP | 5.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|