C17H25ClN4O — CID 68896503
N-[3-(2-amino-1H-imidazol-5-yl)phenyl]-2-ethylhexanamide;hydrochloride (PubChem CID 68896503) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is N-[3-(2-amino-1H-imidazol-5-yl)phenyl]-2-ethylhexanamide;hydrochloride.
| Compound Name | N-[3-(2-amino-1H-imidazol-5-yl)phenyl]-2-ethylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 68896503 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[3-(2-amino-1H-imidazol-5-yl)phenyl]-2-ethylhexanamide;hydrochloride |
| SMILES | CCCCC(CC)C(=O)Nc1cccc(-c2cnc(N)[nH]2)c1.Cl |
| InChI | InChI=1S/C17H24N4O.ClH/c1-3-5-7-12(4-2)16(22)20-14-9-6-8-13(10-14)15-11-19-17(18)21-15;/h6,8-12H,3-5,7H2,1-2H3,(H,20,22)(H3,18,19,21);1H |
| InChIKey | RSQNUCOSSWNXLJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |