C20H19N3OS — CID 3526553
4-methyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 3526553) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3526553 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-methyl-N-[3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | C=CCNc1nc(-c2cccc(NC(=O)c3ccc(C)cc3)c2)cs1 |
| InChI | InChI=1S/C20H19N3OS/c1-3-11-21-20-23-18(13-25-20)16-5-4-6-17(12-16)22-19(24)15-9-7-14(2)8-10-15/h3-10,12-13H,1,11H2,2H3,(H,21,23)(H,22,24) |
| InChIKey | PWPBOARDWHHYJS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|