C20H19N3O2S — CID 10150294
4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid (PubChem CID 10150294) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 10150294 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3ccc(N4CCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c24-19(25)15-3-7-16(8-4-15)21-20-22-18(13-26-20)14-5-9-17(10-6-14)23-11-1-2-12-23/h3-10,13H,1-2,11-12H2,(H,21,22)(H,24,25) |
| InChIKey | WNHCXTUQUSBWBH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |