C18H16N2O2S — CID 23889662
4-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid (PubChem CID 23889662) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 23889662 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
| SMILES | CCc1ccc(-c2csc(Nc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-2-12-3-5-13(6-4-12)16-11-23-18(20-16)19-15-9-7-14(8-10-15)17(21)22/h3-11H,2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | ZPLRNQNCWALJAW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |