C22H23N3O2S — CID 58910528
ethyl 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoate (PubChem CID 58910528) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is ethyl 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58910528 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[[4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(-c3ccc(N4CCCC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-2-27-21(26)17-5-9-18(10-6-17)23-22-24-20(15-28-22)16-7-11-19(12-8-16)25-13-3-4-14-25/h5-12,15H,2-4,13-14H2,1H3,(H,23,24) |
| InChIKey | PTGQNGKSTLDYKD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |