C21H21N3O2S — CID 58910672
4-(1,3-benzodioxol-5-yl)-N-(4-piperidin-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 58910672) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(4-piperidin-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(4-piperidin-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910672 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(4-piperidin-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | c1cc(N2CCCCC2)ccc1Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C21H21N3O2S/c1-2-10-24(11-3-1)17-7-5-16(6-8-17)22-21-23-18(13-27-21)15-4-9-19-20(12-15)26-14-25-19/h4-9,12-13H,1-3,10-11,14H2,(H,22,23) |
| InChIKey | DJHLJBWMFKKMCV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|