C20H20N4O2S — CID 58911009
N-(1,3-benzodioxol-5-yl)-4-(4-piperazin-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 58911009) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(4-piperazin-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(4-piperazin-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58911009 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(4-piperazin-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | c1cc2c(cc1Nc1nc(-c3ccc(N4CCNCC4)cc3)cs1)OCO2 |
| InChI | InChI=1S/C20H20N4O2S/c1-4-16(24-9-7-21-8-10-24)5-2-14(1)17-12-27-20(23-17)22-15-3-6-18-19(11-15)26-13-25-18/h1-6,11-12,21H,7-10,13H2,(H,22,23) |
| InChIKey | GJCXEOSDIJBUOS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |